C32H40O10 — CID 90645363
[(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-4,13-diacetyloxy-10-(hydroxymethyl)-8-methoxy-3,6,6,14-tetramethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl] benzoate (PubChem CID 90645363) has the molecular formula C32H40O10 and a molecular weight of 584.66 g/mol. Its IUPAC name is [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-4,13-diacetyloxy-10-(hydroxymethyl)-8-methoxy-3,6,6,14-tetramethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl] benzoate.
| Compound Name | [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-4,13-diacetyloxy-10-(hydroxymethyl)-8-methoxy-3,6,6,14-tetramethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl] benzoate |
|---|---|
| PubChem CID | 90645363 |
| Molecular Formula | C32H40O10 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-4,13-diacetyloxy-10-(hydroxymethyl)-8-methoxy-3,6,6,14-tetramethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl] benzoate |
| SMILES | CO[C@@H]1[C@H]2[C@@H]([C@@H](OC(C)=O)[C@@H](C)C(=O)[C@@]34C[C@H](C)[C@H](OC(C)=O)[C@]3(/C=C(\CO)[C@H]1OC(=O)c1ccccc1)O4)C2(C)C |
| InChI | InChI=1S/C32H40O10/c1-16-13-31-27(36)17(2)24(39-18(3)34)22-23(30(22,5)6)26(38-7)25(41-29(37)20-11-9-8-10-12-20)21(15-33)14-32(31,42-31)28(16)40-19(4)35/h8-12,14,16-17,22-26,28,33H,13,15H2,1-7H3/b21-14+/t16-,17+,22-,23+,24-,25+,26+,28-,31-,32-/m0/s1 |
| InChIKey | AKGWHNMLBFIDGN-FGDOTZCFSA-N |
| XLogP | 3.05 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|