C30H38O8 — CID 90645369
[(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-13-acetyloxy-4-hydroxy-8-methoxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl] benzoate (PubChem CID 90645369) has the molecular formula C30H38O8 and a molecular weight of 526.63 g/mol. Its IUPAC name is [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-13-acetyloxy-4-hydroxy-8-methoxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl] benzoate.
| Compound Name | [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-13-acetyloxy-4-hydroxy-8-methoxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl] benzoate |
|---|---|
| PubChem CID | 90645369 |
| Molecular Formula | C30H38O8 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-13-acetyloxy-4-hydroxy-8-methoxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-9-yl] benzoate |
| SMILES | CO[C@@H]1[C@H]2[C@@H]([C@@H](O)[C@@H](C)C(=O)[C@@]34C[C@H](C)[C@H](OC(C)=O)[C@]3(/C=C(\C)[C@H]1OC(=O)c1ccccc1)O4)C2(C)C |
| InChI | InChI=1S/C30H38O8/c1-15-13-30-26(36-18(4)31)16(2)14-29(30,38-30)25(33)17(3)22(32)20-21(28(20,5)6)24(35-7)23(15)37-27(34)19-11-9-8-10-12-19/h8-13,16-17,20-24,26,32H,14H2,1-7H3/b15-13+/t16-,17+,20-,21+,22-,23+,24+,26-,29-,30-/m0/s1 |
| InChIKey | VZPHVUNTCDIDFA-WTFNYUBASA-N |
| XLogP | 3.50 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|