C29H42O9 — CID 90645375
[(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-4,9-diacetyloxy-13-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] 2-methylbutanoate (PubChem CID 90645375) has the molecular formula C29H42O9 and a molecular weight of 534.65 g/mol. Its IUPAC name is [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-4,9-diacetyloxy-13-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] 2-methylbutanoate.
| Compound Name | [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-4,9-diacetyloxy-13-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 90645375 |
| Molecular Formula | C29H42O9 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-4,9-diacetyloxy-13-hydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@@H]1[C@H]2[C@@H]([C@@H](OC(C)=O)[C@@H](C)C(=O)[C@@]34C[C@H](C)[C@H](O)[C@]3(/C=C(\C)[C@H]1OC(C)=O)O4)C2(C)C |
| InChI | InChI=1S/C29H42O9/c1-10-13(2)26(34)37-23-20-19(27(20,8)9)22(36-18(7)31)16(5)25(33)29-12-15(4)24(32)28(29,38-29)11-14(3)21(23)35-17(6)30/h11,13,15-16,19-24,32H,10,12H2,1-9H3/b14-11+/t13?,15-,16+,19-,20+,21+,22-,23+,24-,28-,29-/m0/s1 |
| InChIKey | NBOOSGFCVGWEFX-FOZGGXQVSA-N |
| XLogP | 3.15 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|