C29H36O8 — CID 90645376
[(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-13-acetyloxy-4,9-dihydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate (PubChem CID 90645376) has the molecular formula C29H36O8 and a molecular weight of 512.60 g/mol. Its IUPAC name is [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-13-acetyloxy-4,9-dihydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate.
| Compound Name | [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-13-acetyloxy-4,9-dihydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate |
|---|---|
| PubChem CID | 90645376 |
| Molecular Formula | C29H36O8 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | [(1R,3R,4R,5R,7S,8R,9R,10E,12S,13S,14S)-13-acetyloxy-4,9-dihydroxy-3,6,6,10,14-pentamethyl-2-oxo-16-oxatetracyclo[10.3.1.01,12.05,7]hexadec-10-en-8-yl] benzoate |
| SMILES | CC(=O)O[C@H]1[C@@H](C)C[C@@]23O[C@@]12/C=C(\C)[C@@H](O)[C@H](OC(=O)c1ccccc1)[C@H]1[C@@H]([C@@H](O)[C@@H](C)C3=O)C1(C)C |
| InChI | InChI=1S/C29H36O8/c1-14-12-29-25(35-17(4)30)15(2)13-28(29,37-29)24(33)16(3)22(32)19-20(27(19,5)6)23(21(14)31)36-26(34)18-10-8-7-9-11-18/h7-12,15-16,19-23,25,31-32H,13H2,1-6H3/b14-12+/t15-,16+,19-,20+,21+,22-,23+,25-,28-,29-/m0/s1 |
| InChIKey | YZMLIFJKNZEVMR-ABZFVSIZSA-N |
| XLogP | 2.85 |
| TPSA | 122.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|