C18H12BrN7O2S — CID 90645423
4-[12-(4-bromophenyl)-3,4,5,6,8,10-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]benzenesulfonamide (PubChem CID 90645423) has the molecular formula C18H12BrN7O2S and a molecular weight of 470.31 g/mol. Its IUPAC name is 4-[12-(4-bromophenyl)-3,4,5,6,8,10-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]benzenesulfonamide.
| Compound Name | 4-[12-(4-bromophenyl)-3,4,5,6,8,10-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90645423 |
| Molecular Formula | C18H12BrN7O2S |
| Molecular Weight | 470.31 g/mol |
| Exact Mass | 469.00 |
| IUPAC Name | 4-[12-(4-bromophenyl)-3,4,5,6,8,10-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-10-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-n2cc(-c3ccc(Br)cc3)c3c2ncn2nnnc32)cc1 |
| InChI | InChI=1S/C18H12BrN7O2S/c19-12-3-1-11(2-4-12)15-9-25(13-5-7-14(8-6-13)29(20,27)28)17-16(15)18-22-23-24-26(18)10-21-17/h1-10H,(H2,20,27,28) |
| InChIKey | YWRVKUQSWBCUCH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |