About [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate
[4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate (PubChem CID 90645435) has the molecular formula C25H32N4O3
and a molecular weight of 436.56 g/mol. Its IUPAC name is [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate |
| PubChem CID | 90645435 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CCC(CNc2nn(C)c3cccc(OC)c23)(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H32N4O3/c1-4-26-24(30)32-19-13-15-25(16-14-19,18-9-6-5-7-10-18)17-27-23-22-20(29(2)28-23)11-8-12-21(22)31-3/h5-12,19H,4,13-17H2,1-3H3,(H,26,30)(H,27,28) |
| InChIKey | AYMVSAPTKYQTRO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate?
The IUPAC name of [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate (CID 90645435) is [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate.
What is the SMILES notation for [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate?
The canonical SMILES for [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate is CCNC(=O)OC1CCC(CNc2nn(C)c3cccc(OC)c23)(c2ccccc2)CC1.
What is the InChIKey of [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate?
The InChIKey is AYMVSAPTKYQTRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H32N4O3/c1-4-26-24(30)32-19-13-15-25(16-14-19,18-9-6-5-7-10-18)17-27-23-22-20(29(2)28-23)11-8-12-21(22)31-3/h5-12,19H,4,13-17H2,1-3H3,(H,26,30)(H,27,28).
What are the key properties of [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate?
[4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate has a molecular weight of 436.56 g/mol, XLogP of 4.62, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(4-methoxy-1-methylindazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate is sourced from PubChem (CID 90645435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).