About [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate
[4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate (PubChem CID 90645436) has the molecular formula C24H30N4O3
and a molecular weight of 422.53 g/mol. Its IUPAC name is [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate |
| PubChem CID | 90645436 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CCC(CNc2n[nH]c3cccc(OC)c23)(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N4O3/c1-3-25-23(29)31-18-12-14-24(15-13-18,17-8-5-4-6-9-17)16-26-22-21-19(27-28-22)10-7-11-20(21)30-2/h4-11,18H,3,12-16H2,1-2H3,(H,25,29)(H2,26,27,28) |
| InChIKey | WZZPYWCRKLLOTM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate?
The IUPAC name of [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate (CID 90645436) is [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate.
What is the SMILES notation for [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate?
The canonical SMILES for [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate is CCNC(=O)OC1CCC(CNc2n[nH]c3cccc(OC)c23)(c2ccccc2)CC1.
What is the InChIKey of [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate?
The InChIKey is WZZPYWCRKLLOTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N4O3/c1-3-25-23(29)31-18-12-14-24(15-13-18,17-8-5-4-6-9-17)16-26-22-21-19(27-28-22)10-7-11-20(21)30-2/h4-11,18H,3,12-16H2,1-2H3,(H,25,29)(H2,26,27,28).
What are the key properties of [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate?
[4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate has a molecular weight of 422.53 g/mol, XLogP of 4.61, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[(4-methoxy-1H-indazol-3-yl)amino]methyl]-4-phenylcyclohexyl] N-ethylcarbamate is sourced from PubChem (CID 90645436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).