About 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine
2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine (PubChem CID 90645477) has the molecular formula C14H13N3O
and a molecular weight of 239.28 g/mol. Its IUPAC name is 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine |
| PubChem CID | 90645477 |
| Molecular Formula | C14H13N3O |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1nc(Nc2ccccc2)c2cc(C)oc2n1 |
| InChI | InChI=1S/C14H13N3O/c1-9-8-12-13(15-10(2)16-14(12)18-9)17-11-6-4-3-5-7-11/h3-8H,1-2H3,(H,15,16,17) |
| InChIKey | HTNOBSCJRZGDSX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine (CID 90645477) is 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine is Cc1nc(Nc2ccccc2)c2cc(C)oc2n1.
What is the InChIKey of 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine?
The InChIKey is HTNOBSCJRZGDSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O/c1-9-8-12-13(15-10(2)16-14(12)18-9)17-11-6-4-3-5-7-11/h3-8H,1-2H3,(H,15,16,17).
What are the key properties of 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine?
2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine has a molecular weight of 239.28 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-N-phenylfuro[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 90645477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).