C11H17N3S — CID 90645501
[(E)-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)methylideneamino]thiourea (PubChem CID 90645501) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is [(E)-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)methylideneamino]thiourea.
| Compound Name | [(E)-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 90645501 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | [(E)-(2,6,6-trimethylcyclohexa-1,3-dien-1-yl)methylideneamino]thiourea |
| SMILES | CC1=C(/C=N/NC(N)=S)C(C)(C)CC=C1 |
| InChI | InChI=1S/C11H17N3S/c1-8-5-4-6-11(2,3)9(8)7-13-14-10(12)15/h4-5,7H,6H2,1-3H3,(H3,12,14,15)/b13-7+ |
| InChIKey | VFYYWCMVLMGLKX-NTUHNPAUSA-N |
| XLogP | 2.11 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|