C25H26ClN7 — CID 90645509
6-N-[(3-chlorophenyl)methyl]-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[3,2-d]pyrimidine-4,6-diamine (PubChem CID 90645509) has the molecular formula C25H26ClN7 and a molecular weight of 459.99 g/mol. Its IUPAC name is 6-N-[(3-chlorophenyl)methyl]-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[3,2-d]pyrimidine-4,6-diamine.
| Compound Name | 6-N-[(3-chlorophenyl)methyl]-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[3,2-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 90645509 |
| Molecular Formula | C25H26ClN7 |
| Molecular Weight | 459.99 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 6-N-[(3-chlorophenyl)methyl]-4-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrido[3,2-d]pyrimidine-4,6-diamine |
| SMILES | CN1CCN(c2ccc(Nc3ncnc4ccc(NCc5cccc(Cl)c5)nc34)cc2)CC1 |
| InChI | InChI=1S/C25H26ClN7/c1-32-11-13-33(14-12-32)21-7-5-20(6-8-21)30-25-24-22(28-17-29-25)9-10-23(31-24)27-16-18-3-2-4-19(26)15-18/h2-10,15,17H,11-14,16H2,1H3,(H,27,31)(H,28,29,30) |
| InChIKey | SINWNRPVOPGVAE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.99 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|