About 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one
2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one (PubChem CID 90645513) has the molecular formula C15H14N2O2
and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| PubChem CID | 90645513 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one |
| SMILES | O=C1NCCc2nc(COc3ccccc3)ccc21 |
| InChI | InChI=1S/C15H14N2O2/c18-15-13-7-6-11(17-14(13)8-9-16-15)10-19-12-4-2-1-3-5-12/h1-7H,8-10H2,(H,16,18) |
| InChIKey | PHEFWHNKDLACLS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one?
The IUPAC name of 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one (CID 90645513) is 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one.
What is the SMILES notation for 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one?
The canonical SMILES for 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one is O=C1NCCc2nc(COc3ccccc3)ccc21.
What is the InChIKey of 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one?
The InChIKey is PHEFWHNKDLACLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c18-15-13-7-6-11(17-14(13)8-9-16-15)10-19-12-4-2-1-3-5-12/h1-7H,8-10H2,(H,16,18).
What are the key properties of 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one?
2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one has a molecular weight of 254.29 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phenoxymethyl)-7,8-dihydro-6H-1,6-naphthyridin-5-one is sourced from PubChem (CID 90645513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).