About 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one
6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one (PubChem CID 90645521) has the molecular formula C21H17FN2O2
and a molecular weight of 348.38 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one |
| PubChem CID | 90645521 |
| Molecular Formula | C21H17FN2O2 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one |
| SMILES | O=C1c2ccc(COc3ccccc3)nc2CCN1c1ccc(F)cc1 |
| InChI | InChI=1S/C21H17FN2O2/c22-15-6-9-17(10-7-15)24-13-12-20-19(21(24)25)11-8-16(23-20)14-26-18-4-2-1-3-5-18/h1-11H,12-14H2 |
| InChIKey | ZGDYNIFWSYGQCF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one?
The IUPAC name of 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one (CID 90645521) is 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one.
What is the SMILES notation for 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one?
The canonical SMILES for 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one is O=C1c2ccc(COc3ccccc3)nc2CCN1c1ccc(F)cc1.
What is the InChIKey of 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one?
The InChIKey is ZGDYNIFWSYGQCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FN2O2/c22-15-6-9-17(10-7-15)24-13-12-20-19(21(24)25)11-8-16(23-20)14-26-18-4-2-1-3-5-18/h1-11H,12-14H2.
What are the key properties of 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one?
6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one has a molecular weight of 348.38 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-fluorophenyl)-2-(phenoxymethyl)-7,8-dihydro-1,6-naphthyridin-5-one is sourced from PubChem (CID 90645521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).