About 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole
3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole (PubChem CID 90646320) has the molecular formula C21H26FN5
and a molecular weight of 367.47 g/mol. Its IUPAC name is 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole.
Molecular Properties
| Compound Name | 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole |
| PubChem CID | 90646320 |
| Molecular Formula | C21H26FN5 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole |
| SMILES | Cc1cc(C)nc(N2CCN(CCCc3c[nH]c4ccc(F)cc34)CC2)n1 |
| InChI | InChI=1S/C21H26FN5/c1-15-12-16(2)25-21(24-15)27-10-8-26(9-11-27)7-3-4-17-14-23-20-6-5-18(22)13-19(17)20/h5-6,12-14,23H,3-4,7-11H2,1-2H3 |
| InChIKey | QGJIFPGQFKHCGK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole?
The IUPAC name of 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole (CID 90646320) is 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole.
What is the SMILES notation for 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole?
The canonical SMILES for 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole is Cc1cc(C)nc(N2CCN(CCCc3c[nH]c4ccc(F)cc34)CC2)n1.
What is the InChIKey of 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole?
The InChIKey is QGJIFPGQFKHCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26FN5/c1-15-12-16(2)25-21(24-15)27-10-8-26(9-11-27)7-3-4-17-14-23-20-6-5-18(22)13-19(17)20/h5-6,12-14,23H,3-4,7-11H2,1-2H3.
What are the key properties of 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole?
3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole has a molecular weight of 367.47 g/mol, XLogP of 3.47, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]propyl]-5-fluoro-1H-indole is sourced from PubChem (CID 90646320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).