About 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole
3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole (PubChem CID 90646410) has the molecular formula C22H28FN5
and a molecular weight of 381.50 g/mol. Its IUPAC name is 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole.
Molecular Properties
| Compound Name | 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole |
| PubChem CID | 90646410 |
| Molecular Formula | C22H28FN5 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole |
| SMILES | Cc1cc(C)nc(N2CCN(CCCCc3c[nH]c4ccc(F)cc34)CC2)n1 |
| InChI | InChI=1S/C22H28FN5/c1-16-13-17(2)26-22(25-16)28-11-9-27(10-12-28)8-4-3-5-18-15-24-21-7-6-19(23)14-20(18)21/h6-7,13-15,24H,3-5,8-12H2,1-2H3 |
| InChIKey | NKNLCLRUTBFCOF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole?
The IUPAC name of 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole (CID 90646410) is 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole.
What is the SMILES notation for 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole?
The canonical SMILES for 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole is Cc1cc(C)nc(N2CCN(CCCCc3c[nH]c4ccc(F)cc34)CC2)n1.
What is the InChIKey of 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole?
The InChIKey is NKNLCLRUTBFCOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28FN5/c1-16-13-17(2)26-22(25-16)28-11-9-27(10-12-28)8-4-3-5-18-15-24-21-7-6-19(23)14-20(18)21/h6-7,13-15,24H,3-5,8-12H2,1-2H3.
What are the key properties of 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole?
3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole has a molecular weight of 381.50 g/mol, XLogP of 3.86, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]butyl]-5-fluoro-1H-indole is sourced from PubChem (CID 90646410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).