About 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one
10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one (PubChem CID 90646534) has the molecular formula C20H16ClN3OS
and a molecular weight of 381.89 g/mol. Its IUPAC name is 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one.
Molecular Properties
| Compound Name | 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one |
| PubChem CID | 90646534 |
| Molecular Formula | C20H16ClN3OS |
| Molecular Weight | 381.89 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one |
| SMILES | O=c1c2cc(Cl)ccc2sc2c(N3CCNCC3)nc3ccccc3c12 |
| InChI | InChI=1S/C20H16ClN3OS/c21-12-5-6-16-14(11-12)18(25)17-13-3-1-2-4-15(13)23-20(19(17)26-16)24-9-7-22-8-10-24/h1-6,11,22H,7-10H2 |
| InChIKey | PCNVXSYOTFIZLG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.89 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one?
The IUPAC name of 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one (CID 90646534) is 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one.
What is the SMILES notation for 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one?
The canonical SMILES for 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one is O=c1c2cc(Cl)ccc2sc2c(N3CCNCC3)nc3ccccc3c12.
What is the InChIKey of 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one?
The InChIKey is PCNVXSYOTFIZLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClN3OS/c21-12-5-6-16-14(11-12)18(25)17-13-3-1-2-4-15(13)23-20(19(17)26-16)24-9-7-22-8-10-24/h1-6,11,22H,7-10H2.
What are the key properties of 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one?
10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one has a molecular weight of 381.89 g/mol, XLogP of 4.03, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 10-chloro-6-piperazin-1-ylthiochromeno[2,3-c]quinolin-12-one is sourced from PubChem (CID 90646534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).