C14H18FNO4S2 — CID 90648070
3-[(4-fluorophenyl)methylsulfanyl]-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]propanamide (PubChem CID 90648070) has the molecular formula C14H18FNO4S2 and a molecular weight of 347.43 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methylsulfanyl]-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]propanamide.
| Compound Name | 3-[(4-fluorophenyl)methylsulfanyl]-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]propanamide |
|---|---|
| PubChem CID | 90648070 |
| Molecular Formula | C14H18FNO4S2 |
| Molecular Weight | 347.43 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 3-[(4-fluorophenyl)methylsulfanyl]-N-[(3S,4S)-4-hydroxy-1,1-dioxothiolan-3-yl]propanamide |
| SMILES | O=C(CCSCc1ccc(F)cc1)N[C@@H]1CS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C14H18FNO4S2/c15-11-3-1-10(2-4-11)7-21-6-5-14(18)16-12-8-22(19,20)9-13(12)17/h1-4,12-13,17H,5-9H2,(H,16,18)/t12-,13-/m1/s1 |
| InChIKey | MBBISRPCWMJVJB-CHWSQXEVSA-N |
| XLogP | 0.72 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|