C13H23N3O3S2 — CID 90648824
1-[5-(3-methylsulfanylpropyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]-2-methylsulfonylethanol (PubChem CID 90648824) has the molecular formula C13H23N3O3S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is 1-[5-(3-methylsulfanylpropyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]-2-methylsulfonylethanol.
| Compound Name | 1-[5-(3-methylsulfanylpropyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 90648824 |
| Molecular Formula | C13H23N3O3S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-[5-(3-methylsulfanylpropyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazin-2-yl]-2-methylsulfonylethanol |
| SMILES | CSCCCN1CCn2nc(C(O)CS(C)(=O)=O)cc2C1 |
| InChI | InChI=1S/C13H23N3O3S2/c1-20-7-3-4-15-5-6-16-11(9-15)8-12(14-16)13(17)10-21(2,18)19/h8,13,17H,3-7,9-10H2,1-2H3 |
| InChIKey | BBVQDROIFRNNBB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|