C20H23N5O3 — CID 90648964
5,7-dimethyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide (PubChem CID 90648964) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is 5,7-dimethyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide.
| Compound Name | 5,7-dimethyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 90648964 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 5,7-dimethyl-N-[(3R,4S)-4-phenylmethoxyoxan-3-yl]-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(C)n2c(C(=O)N[C@@H]3COCC[C@@H]3OCc3ccccc3)nnc2n1 |
| InChI | InChI=1S/C20H23N5O3/c1-13-10-14(2)25-18(23-24-20(25)21-13)19(26)22-16-12-27-9-8-17(16)28-11-15-6-4-3-5-7-15/h3-7,10,16-17H,8-9,11-12H2,1-2H3,(H,22,26)/t16-,17+/m1/s1 |
| InChIKey | RDIVLOYUJSJYDA-SJORKVTESA-N |
| XLogP | 1.85 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |