C17H15N5O — CID 90650149
6-cyano-N-[(1-ethylbenzimidazol-2-yl)methyl]pyridine-3-carboxamide (PubChem CID 90650149) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 6-cyano-N-[(1-ethylbenzimidazol-2-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 6-cyano-N-[(1-ethylbenzimidazol-2-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 90650149 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 6-cyano-N-[(1-ethylbenzimidazol-2-yl)methyl]pyridine-3-carboxamide |
| SMILES | CCn1c(CNC(=O)c2ccc(C#N)nc2)nc2ccccc21 |
| InChI | InChI=1S/C17H15N5O/c1-2-22-15-6-4-3-5-14(15)21-16(22)11-20-17(23)12-7-8-13(9-18)19-10-12/h3-8,10H,2,11H2,1H3,(H,20,23) |
| InChIKey | RZFNKPCXNNNCMQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |