C19H23N3O2 — CID 90651078
4-phenoxy-1-(3-pyrimidin-4-ylpiperidin-1-yl)butan-1-one (PubChem CID 90651078) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-phenoxy-1-(3-pyrimidin-4-ylpiperidin-1-yl)butan-1-one.
| Compound Name | 4-phenoxy-1-(3-pyrimidin-4-ylpiperidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 90651078 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-phenoxy-1-(3-pyrimidin-4-ylpiperidin-1-yl)butan-1-one |
| SMILES | O=C(CCCOc1ccccc1)N1CCCC(c2ccncn2)C1 |
| InChI | InChI=1S/C19H23N3O2/c23-19(9-5-13-24-17-7-2-1-3-8-17)22-12-4-6-16(14-22)18-10-11-20-15-21-18/h1-3,7-8,10-11,15-16H,4-6,9,12-14H2 |
| InChIKey | IALJETGXGYDZEL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|