C15H17N3O2S — CID 90651685
2-(3-methoxyphenyl)sulfanyl-N-methyl-N-(pyrazin-2-ylmethyl)acetamide (PubChem CID 90651685) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)sulfanyl-N-methyl-N-(pyrazin-2-ylmethyl)acetamide.
| Compound Name | 2-(3-methoxyphenyl)sulfanyl-N-methyl-N-(pyrazin-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 90651685 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(3-methoxyphenyl)sulfanyl-N-methyl-N-(pyrazin-2-ylmethyl)acetamide |
| SMILES | COc1cccc(SCC(=O)N(C)Cc2cnccn2)c1 |
| InChI | InChI=1S/C15H17N3O2S/c1-18(10-12-9-16-6-7-17-12)15(19)11-21-14-5-3-4-13(8-14)20-2/h3-9H,10-11H2,1-2H3 |
| InChIKey | UARPKKDBBPUGMP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |