C20H20N2O2S — CID 90651890
1-benzothiophen-2-yl-[4-[hydroxy(pyridin-2-yl)methyl]piperidin-1-yl]methanone (PubChem CID 90651890) has the molecular formula C20H20N2O2S and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-benzothiophen-2-yl-[4-[hydroxy(pyridin-2-yl)methyl]piperidin-1-yl]methanone.
| Compound Name | 1-benzothiophen-2-yl-[4-[hydroxy(pyridin-2-yl)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90651890 |
| Molecular Formula | C20H20N2O2S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-benzothiophen-2-yl-[4-[hydroxy(pyridin-2-yl)methyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2s1)N1CCC(C(O)c2ccccn2)CC1 |
| InChI | InChI=1S/C20H20N2O2S/c23-19(16-6-3-4-10-21-16)14-8-11-22(12-9-14)20(24)18-13-15-5-1-2-7-17(15)25-18/h1-7,10,13-14,19,23H,8-9,11-12H2 |
| InChIKey | ZXQASDFNAFGOEF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |