C13H16ClNO2S — CID 90652097
1-[3-(3-chlorophenoxy)azetidin-1-yl]-2-ethylsulfanylethanone (PubChem CID 90652097) has the molecular formula C13H16ClNO2S and a molecular weight of 285.80 g/mol. Its IUPAC name is 1-[3-(3-chlorophenoxy)azetidin-1-yl]-2-ethylsulfanylethanone.
| Compound Name | 1-[3-(3-chlorophenoxy)azetidin-1-yl]-2-ethylsulfanylethanone |
|---|---|
| PubChem CID | 90652097 |
| Molecular Formula | C13H16ClNO2S |
| Molecular Weight | 285.80 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-[3-(3-chlorophenoxy)azetidin-1-yl]-2-ethylsulfanylethanone |
| SMILES | CCSCC(=O)N1CC(Oc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C13H16ClNO2S/c1-2-18-9-13(16)15-7-12(8-15)17-11-5-3-4-10(14)6-11/h3-6,12H,2,7-9H2,1H3 |
| InChIKey | QZSBNNNXWXDVAS-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.80 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |