C23H27N3O2 — CID 90653195
1-[5-(2,2-diphenylethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]ethane-1,2-diol (PubChem CID 90653195) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[5-(2,2-diphenylethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]ethane-1,2-diol.
| Compound Name | 1-[5-(2,2-diphenylethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 90653195 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-[5-(2,2-diphenylethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-2-yl]ethane-1,2-diol |
| SMILES | OCC(O)c1cc2n(n1)CCCN(CC(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C23H27N3O2/c27-17-23(28)22-14-20-15-25(12-7-13-26(20)24-22)16-21(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,14,21,23,27-28H,7,12-13,15-17H2 |
| InChIKey | KCKICXQLMRHMDZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |