C20H20N4O2 — CID 90653338
N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrrolidin-1-ylbenzamide (PubChem CID 90653338) has the molecular formula C20H20N4O2 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrrolidin-1-ylbenzamide.
| Compound Name | N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrrolidin-1-ylbenzamide |
|---|---|
| PubChem CID | 90653338 |
| Molecular Formula | C20H20N4O2 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | N-[(5-phenyl-1,2,4-oxadiazol-3-yl)methyl]-2-pyrrolidin-1-ylbenzamide |
| SMILES | O=C(NCc1noc(-c2ccccc2)n1)c1ccccc1N1CCCC1 |
| InChI | InChI=1S/C20H20N4O2/c25-19(16-10-4-5-11-17(16)24-12-6-7-13-24)21-14-18-22-20(26-23-18)15-8-2-1-3-9-15/h1-5,8-11H,6-7,12-14H2,(H,21,25) |
| InChIKey | RHACLBPVJAZISS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |