C19H24FN3O3 — CID 90653375
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1S,2S)-2-[(4-fluorophenyl)methyl]cyclopentyl]acetamide (PubChem CID 90653375) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1S,2S)-2-[(4-fluorophenyl)methyl]cyclopentyl]acetamide.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1S,2S)-2-[(4-fluorophenyl)methyl]cyclopentyl]acetamide |
|---|---|
| PubChem CID | 90653375 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-N-[(1S,2S)-2-[(4-fluorophenyl)methyl]cyclopentyl]acetamide |
| SMILES | CC1(C)NC(=O)N(CC(=O)N[C@H]2CCC[C@H]2Cc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C19H24FN3O3/c1-19(2)17(25)23(18(26)22-19)11-16(24)21-15-5-3-4-13(15)10-12-6-8-14(20)9-7-12/h6-9,13,15H,3-5,10-11H2,1-2H3,(H,21,24)(H,22,26)/t13-,15-/m0/s1 |
| InChIKey | IQVNHFJDFUHOTH-ZFWWWQNUSA-N |
| XLogP | 1.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|