C20H23N7O2 — CID 90654052
2-[(E)-1-[3-[(1S)-1-(1,6-dimethylindazol-5-yl)ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylideneamino]oxyethanol (PubChem CID 90654052) has the molecular formula C20H23N7O2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 2-[(E)-1-[3-[(1S)-1-(1,6-dimethylindazol-5-yl)ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylideneamino]oxyethanol.
| Compound Name | 2-[(E)-1-[3-[(1S)-1-(1,6-dimethylindazol-5-yl)ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylideneamino]oxyethanol |
|---|---|
| PubChem CID | 90654052 |
| Molecular Formula | C20H23N7O2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 2-[(E)-1-[3-[(1S)-1-(1,6-dimethylindazol-5-yl)ethyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-yl]ethylideneamino]oxyethanol |
| SMILES | C/C(=N\OCCO)c1ccc2nnc([C@@H](C)c3cc4cnn(C)c4cc3C)n2n1 |
| InChI | InChI=1S/C20H23N7O2/c1-12-9-18-15(11-21-26(18)4)10-16(12)13(2)20-23-22-19-6-5-17(24-27(19)20)14(3)25-29-8-7-28/h5-6,9-11,13,28H,7-8H2,1-4H3/b25-14+/t13-/m0/s1 |
| InChIKey | LPLGDAPTTKRQQY-VPWNXDJNSA-N |
| XLogP | 2.20 |
| TPSA | 102.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|