C33H41N5O3 — CID 90654201
[3-(2-acetamidoethyl)-1H-indol-5-yl] N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]carbamate (PubChem CID 90654201) has the molecular formula C33H41N5O3 and a molecular weight of 555.72 g/mol. Its IUPAC name is [3-(2-acetamidoethyl)-1H-indol-5-yl] N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]carbamate.
| Compound Name | [3-(2-acetamidoethyl)-1H-indol-5-yl] N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]carbamate |
|---|---|
| PubChem CID | 90654201 |
| Molecular Formula | C33H41N5O3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | [3-(2-acetamidoethyl)-1H-indol-5-yl] N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]carbamate |
| SMILES | CC(=O)NCCc1c[nH]c2ccc(OC(=O)NCCCCCCCNc3c4c(nc5ccccc35)CCCC4)cc12 |
| InChI | InChI=1S/C33H41N5O3/c1-23(39)34-20-17-24-22-37-29-16-15-25(21-28(24)29)41-33(40)36-19-10-4-2-3-9-18-35-32-26-11-5-7-13-30(26)38-31-14-8-6-12-27(31)32/h5,7,11,13,15-16,21-22,37H,2-4,6,8-10,12,14,17-20H2,1H3,(H,34,39)(H,35,38)(H,36,40) |
| InChIKey | AKQSCHLJARNVMJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|