C28H31N5O3 — CID 90654202
[3-(2-acetamidoethyl)-1H-indol-5-yl] N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]carbamate (PubChem CID 90654202) has the molecular formula C28H31N5O3 and a molecular weight of 485.59 g/mol. Its IUPAC name is [3-(2-acetamidoethyl)-1H-indol-5-yl] N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]carbamate.
| Compound Name | [3-(2-acetamidoethyl)-1H-indol-5-yl] N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]carbamate |
|---|---|
| PubChem CID | 90654202 |
| Molecular Formula | C28H31N5O3 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | [3-(2-acetamidoethyl)-1H-indol-5-yl] N-[2-(1,2,3,4-tetrahydroacridin-9-ylamino)ethyl]carbamate |
| SMILES | CC(=O)NCCc1c[nH]c2ccc(OC(=O)NCCNc3c4c(nc5ccccc35)CCCC4)cc12 |
| InChI | InChI=1S/C28H31N5O3/c1-18(34)29-13-12-19-17-32-24-11-10-20(16-23(19)24)36-28(35)31-15-14-30-27-21-6-2-4-8-25(21)33-26-9-5-3-7-22(26)27/h2,4,6,8,10-11,16-17,32H,3,5,7,9,12-15H2,1H3,(H,29,34)(H,30,33)(H,31,35) |
| InChIKey | WSXAJVAWKDKQHT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|