C73H107N14O17 — CID 90654222
CID 90654222 (PubChem CID 90654222) has the molecular formula C73H107N14O17 and a molecular weight of 1452.74 g/mol.
| Compound Name | CID 90654222 |
|---|---|
| PubChem CID | 90654222 |
| Molecular Formula | C73H107N14O17 |
| Molecular Weight | 1452.74 g/mol |
| Exact Mass | 1451.79 |
| IUPAC Name | — |
| SMILES | Cc1c2oc3c(C)ccc(C(=O)N[C@@H]4C(=O)N[C@H](C(C)C)C(=O)N5CCC[C@H]5C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]4C)c3nc-2c(C(=O)N[C@@H]2C(=O)N[C@H](C(C)C)C(=O)N3CCC[C@H]3C(=O)N(C)CC(=O)N(C)[C@@H](C(C)C)C(=O)O[C@@H]2C)c(NCCNC2CC(C)(C)N([O])C(C)(C)C2)c1=O |
| InChI | InChI=1S/C73H107N14O17/c1-35(2)50-68(97)85-29-21-23-45(85)66(95)81(17)33-47(88)83(19)57(37(5)6)70(99)102-41(11)52(64(93)77-50)79-62(91)44-26-25-39(9)60-54(44)76-56-49(55(59(90)40(10)61(56)104-60)75-28-27-74-43-31-72(13,14)87(101)73(15,16)32-43)63(92)80-53-42(12)103-71(100)58(38(7)8)84(20)48(89)34-82(18)67(96)46-24-22-30-86(46)69(98)51(36(3)4)78-65(53)94/h25-26,35-38,41-43,45-46,50-53,57-58,74-75H,21-24,27-34H2,1-20H3,(H,77,93)(H,78,94)(H,79,91)(H,80,92)/t41-,42-,45+,46+,50-,51-,52+,53+,57+,58+/m1/s1 |
| InChIKey | UPWIFRULFKTWNH-PIZDXTMUSA-N |
| XLogP | 2.51 |
| TPSA | 381.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 104 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1452.74 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|