About (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole
(E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole (PubChem CID 90654227) has the molecular formula C14H14N2O4
and a molecular weight of 274.28 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole |
| PubChem CID | 90654227 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole |
| SMILES | O=C(O)/C=C/C(=O)O.c1ccc2c(c1)CN1CCN=C21 |
| InChI | InChI=1S/C10H10N2.C4H4O4/c1-2-4-9-8(3-1)7-12-6-5-11-10(9)12;5-3(6)1-2-4(7)8/h1-4H,5-7H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RJHKHGJIWAVPSX-WLHGVMLRSA-N |
| XLogP | 0.97 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole?
The IUPAC name of (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole (CID 90654227) is (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole.
What is the SMILES notation for (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole?
The canonical SMILES for (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole is O=C(O)/C=C/C(=O)O.c1ccc2c(c1)CN1CCN=C21.
What is the InChIKey of (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole?
The InChIKey is RJHKHGJIWAVPSX-WLHGVMLRSA-N. The full InChI is InChI=1S/C10H10N2.C4H4O4/c1-2-4-9-8(3-1)7-12-6-5-11-10(9)12;5-3(6)1-2-4(7)8/h1-4H,5-7H2;1-2H,(H,5,6)(H,7,8)/b;2-1+.
What are the key properties of (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole?
(E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole has a molecular weight of 274.28 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;3,5-dihydro-2H-imidazo[2,1-a]isoindole is sourced from PubChem (CID 90654227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).