About 3-propyl-1,3-thiazolidin-2-imine;hydrobromide
3-propyl-1,3-thiazolidin-2-imine;hydrobromide (PubChem CID 90654238) has the molecular formula C6H13BrN2S
and a molecular weight of 225.15 g/mol. Its IUPAC name is 3-propyl-1,3-thiazolidin-2-imine;hydrobromide.
Molecular Properties
| Compound Name | 3-propyl-1,3-thiazolidin-2-imine;hydrobromide |
| PubChem CID | 90654238 |
| Molecular Formula | C6H13BrN2S |
| Molecular Weight | 225.15 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 3-propyl-1,3-thiazolidin-2-imine;hydrobromide |
| SMILES | Br.[H]/N=C1\SCCN1CCC |
| InChI | InChI=1S/C6H12N2S.BrH/c1-2-3-8-4-5-9-6(8)7;/h7H,2-5H2,1H3;1H/b7-6-; |
| InChIKey | AJFIIRVOIYFEAS-NAFXZHHSSA-N |
| XLogP | 1.96 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-propyl-1,3-thiazolidin-2-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1,3-thiazolidin-2-imine;hydrobromide?
The IUPAC name of 3-propyl-1,3-thiazolidin-2-imine;hydrobromide (CID 90654238) is 3-propyl-1,3-thiazolidin-2-imine;hydrobromide.
What is the SMILES notation for 3-propyl-1,3-thiazolidin-2-imine;hydrobromide?
The canonical SMILES for 3-propyl-1,3-thiazolidin-2-imine;hydrobromide is Br.[H]/N=C1\SCCN1CCC.
What is the InChIKey of 3-propyl-1,3-thiazolidin-2-imine;hydrobromide?
The InChIKey is AJFIIRVOIYFEAS-NAFXZHHSSA-N. The full InChI is InChI=1S/C6H12N2S.BrH/c1-2-3-8-4-5-9-6(8)7;/h7H,2-5H2,1H3;1H/b7-6-;.
What are the key properties of 3-propyl-1,3-thiazolidin-2-imine;hydrobromide?
3-propyl-1,3-thiazolidin-2-imine;hydrobromide has a molecular weight of 225.15 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1,3-thiazolidin-2-imine;hydrobromide is sourced from PubChem (CID 90654238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).