C11H16N2O4 — CID 90654249
(E)-but-2-enedioic acid;2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine (PubChem CID 90654249) has the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine.
| Compound Name | (E)-but-2-enedioic acid;2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 90654249 |
| Molecular Formula | C11H16N2O4 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | (E)-but-2-enedioic acid;2,3,4,6,7,8-hexahydropyrrolo[1,2-a]pyrimidine |
| SMILES | C1CN=C2CCCN2C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C7H12N2.C4H4O4/c1-3-7-8-4-2-6-9(7)5-1;5-3(6)1-2-4(7)8/h1-6H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | VGEAOEFWEDLEIP-WLHGVMLRSA-N |
| XLogP | 0.60 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|