C12H18N2O4 — CID 90654250
(E)-but-2-enedioic acid;3,4,6,7,8,9-hexahydro-2H-pyrido[1,2-a]pyrimidine (PubChem CID 90654250) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3,4,6,7,8,9-hexahydro-2H-pyrido[1,2-a]pyrimidine.
| Compound Name | (E)-but-2-enedioic acid;3,4,6,7,8,9-hexahydro-2H-pyrido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 90654250 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (E)-but-2-enedioic acid;3,4,6,7,8,9-hexahydro-2H-pyrido[1,2-a]pyrimidine |
| SMILES | C1CCN2CCCN=C2C1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C8H14N2.C4H4O4/c1-2-6-10-7-3-5-9-8(10)4-1;5-3(6)1-2-4(7)8/h1-7H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PTDYANYEEZMXRD-WLHGVMLRSA-N |
| XLogP | 0.99 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|