About 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride
1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride (PubChem CID 90654270) has the molecular formula C10H21ClN2O2
and a molecular weight of 236.74 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride.
Molecular Properties
| Compound Name | 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride |
| PubChem CID | 90654270 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride |
| SMILES | Cl.[H]/N=C1\CCCN1CC(OCC)OCC |
| InChI | InChI=1S/C10H20N2O2.ClH/c1-3-13-10(14-4-2)8-12-7-5-6-9(12)11;/h10-11H,3-8H2,1-2H3;1H/b11-9+; |
| InChIKey | REDACVUGCNTCOS-LBEJWNQZSA-N |
| XLogP | 1.88 |
| TPSA | 45.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride?
The IUPAC name of 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride (CID 90654270) is 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride.
What is the SMILES notation for 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride?
The canonical SMILES for 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride is Cl.[H]/N=C1\CCCN1CC(OCC)OCC.
What is the InChIKey of 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride?
The InChIKey is REDACVUGCNTCOS-LBEJWNQZSA-N. The full InChI is InChI=1S/C10H20N2O2.ClH/c1-3-13-10(14-4-2)8-12-7-5-6-9(12)11;/h10-11H,3-8H2,1-2H3;1H/b11-9+;.
What are the key properties of 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride?
1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride has a molecular weight of 236.74 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-diethoxyethyl)pyrrolidin-2-imine;hydrochloride is sourced from PubChem (CID 90654270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).