About 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide
1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide (PubChem CID 90654284) has the molecular formula C7H8BrF3N2
and a molecular weight of 257.05 g/mol. Its IUPAC name is 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide.
Molecular Properties
| Compound Name | 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide |
| PubChem CID | 90654284 |
| Molecular Formula | C7H8BrF3N2 |
| Molecular Weight | 257.05 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide |
| SMILES | Br.[H]/N=c1\ccccn1CC(F)(F)F |
| InChI | InChI=1S/C7H7F3N2.BrH/c8-7(9,10)5-12-4-2-1-3-6(12)11;/h1-4,11H,5H2;1H/b11-6+; |
| InChIKey | UPMNWMHVXPWAEM-ICSBZGNSSA-N |
| XLogP | 2.11 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.05 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide?
The IUPAC name of 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide (CID 90654284) is 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide.
What is the SMILES notation for 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide?
The canonical SMILES for 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide is Br.[H]/N=c1\ccccn1CC(F)(F)F.
What is the InChIKey of 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide?
The InChIKey is UPMNWMHVXPWAEM-ICSBZGNSSA-N. The full InChI is InChI=1S/C7H7F3N2.BrH/c8-7(9,10)5-12-4-2-1-3-6(12)11;/h1-4,11H,5H2;1H/b11-6+;.
What are the key properties of 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide?
1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide has a molecular weight of 257.05 g/mol, XLogP of 2.11, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2,2-trifluoroethyl)pyridin-2-imine;hydrobromide is sourced from PubChem (CID 90654284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).