About 6-fluoro-N,1-dimethylpyridin-2-imine
6-fluoro-N,1-dimethylpyridin-2-imine (PubChem CID 90654297) has the molecular formula C7H9FN2
and a molecular weight of 140.16 g/mol. Its IUPAC name is 6-fluoro-N,1-dimethylpyridin-2-imine.
Molecular Properties
| Compound Name | 6-fluoro-N,1-dimethylpyridin-2-imine |
| PubChem CID | 90654297 |
| Molecular Formula | C7H9FN2 |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 6-fluoro-N,1-dimethylpyridin-2-imine |
| SMILES | C/N=c1\cccc(F)n1C |
| InChI | InChI=1S/C7H9FN2/c1-9-7-5-3-4-6(8)10(7)2/h3-5H,1-2H3/b9-7+ |
| InChIKey | ZDJQOQRSJUDWKW-VQHVLOKHSA-N |
| XLogP | 0.69 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-N,1-dimethylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N,1-dimethylpyridin-2-imine?
The IUPAC name of 6-fluoro-N,1-dimethylpyridin-2-imine (CID 90654297) is 6-fluoro-N,1-dimethylpyridin-2-imine.
What is the SMILES notation for 6-fluoro-N,1-dimethylpyridin-2-imine?
The canonical SMILES for 6-fluoro-N,1-dimethylpyridin-2-imine is C/N=c1\cccc(F)n1C.
What is the InChIKey of 6-fluoro-N,1-dimethylpyridin-2-imine?
The InChIKey is ZDJQOQRSJUDWKW-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H9FN2/c1-9-7-5-3-4-6(8)10(7)2/h3-5H,1-2H3/b9-7+.
What are the key properties of 6-fluoro-N,1-dimethylpyridin-2-imine?
6-fluoro-N,1-dimethylpyridin-2-imine has a molecular weight of 140.16 g/mol, XLogP of 0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N,1-dimethylpyridin-2-imine is sourced from PubChem (CID 90654297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).