C24H42N4O2 — CID 90654389
(2S)-N-[(2S,7R,9S,13S)-4-(2-cyclohexylethyl)-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide (PubChem CID 90654389) has the molecular formula C24H42N4O2 and a molecular weight of 418.63 g/mol. Its IUPAC name is (2S)-N-[(2S,7R,9S,13S)-4-(2-cyclohexylethyl)-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(2S,7R,9S,13S)-4-(2-cyclohexylethyl)-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 90654389 |
| Molecular Formula | C24H42N4O2 |
| Molecular Weight | 418.63 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (2S)-N-[(2S,7R,9S,13S)-4-(2-cyclohexylethyl)-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H]1CCC[C@H]2C[C@H]3CCN(CCC4CCCCC4)C[C@H]3N2C1=O |
| InChI | InChI=1S/C24H42N4O2/c1-17(25-2)23(29)26-21-10-6-9-20-15-19-12-14-27(16-22(19)28(20)24(21)30)13-11-18-7-4-3-5-8-18/h17-22,25H,3-16H2,1-2H3,(H,26,29)/t17-,19+,20-,21-,22+/m0/s1 |
| InChIKey | GEYKOEMFFXGUPN-WFMNFSIZSA-N |
| XLogP | 2.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.63 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |