C23H40N4O2 — CID 90654390
(2S)-N-[(2S,7R,9S,13S)-4-(cyclohexylmethyl)-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide (PubChem CID 90654390) has the molecular formula C23H40N4O2 and a molecular weight of 404.60 g/mol. Its IUPAC name is (2S)-N-[(2S,7R,9S,13S)-4-(cyclohexylmethyl)-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(2S,7R,9S,13S)-4-(cyclohexylmethyl)-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 90654390 |
| Molecular Formula | C23H40N4O2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | (2S)-N-[(2S,7R,9S,13S)-4-(cyclohexylmethyl)-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide |
| SMILES | CN[C@@H](C)C(=O)N[C@H]1CCC[C@H]2C[C@H]3CCN(CC4CCCCC4)C[C@H]3N2C1=O |
| InChI | InChI=1S/C23H40N4O2/c1-16(24-2)22(28)25-20-10-6-9-19-13-18-11-12-26(14-17-7-4-3-5-8-17)15-21(18)27(19)23(20)29/h16-21,24H,3-15H2,1-2H3,(H,25,28)/t16-,18+,19-,20-,21+/m0/s1 |
| InChIKey | MHDMVZCYMNLADX-DARKYYSBSA-N |
| XLogP | 2.13 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |