C20H36N4O2 — CID 90654393
(2S)-N-[(2S,7R,9S,13S)-4-butyl-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide (PubChem CID 90654393) has the molecular formula C20H36N4O2 and a molecular weight of 364.53 g/mol. Its IUPAC name is (2S)-N-[(2S,7R,9S,13S)-4-butyl-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide.
| Compound Name | (2S)-N-[(2S,7R,9S,13S)-4-butyl-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 90654393 |
| Molecular Formula | C20H36N4O2 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (2S)-N-[(2S,7R,9S,13S)-4-butyl-14-oxo-1,4-diazatricyclo[7.5.0.02,7]tetradecan-13-yl]-2-(methylamino)propanamide |
| SMILES | CCCCN1CC[C@@H]2C[C@@H]3CCC[C@H](NC(=O)[C@H](C)NC)C(=O)N3[C@@H]2C1 |
| InChI | InChI=1S/C20H36N4O2/c1-4-5-10-23-11-9-15-12-16-7-6-8-17(22-19(25)14(2)21-3)20(26)24(16)18(15)13-23/h14-18,21H,4-13H2,1-3H3,(H,22,25)/t14-,15+,16-,17-,18+/m0/s1 |
| InChIKey | AXRRPACNXDOFRZ-FLXSYLCISA-N |
| XLogP | 1.35 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |