C24H29N9 — CID 90654462
8-(4-methylcyclohexyl)-N-(6-piperazin-1-ylpyridazin-3-yl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 90654462) has the molecular formula C24H29N9 and a molecular weight of 443.56 g/mol. Its IUPAC name is 8-(4-methylcyclohexyl)-N-(6-piperazin-1-ylpyridazin-3-yl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-(4-methylcyclohexyl)-N-(6-piperazin-1-ylpyridazin-3-yl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 90654462 |
| Molecular Formula | C24H29N9 |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 8-(4-methylcyclohexyl)-N-(6-piperazin-1-ylpyridazin-3-yl)-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CC1CCC(n2c3cnccc3c3cnc(Nc4ccc(N5CCNCC5)nn4)nc32)CC1 |
| InChI | InChI=1S/C24H29N9/c1-16-2-4-17(5-3-16)33-20-15-26-9-8-18(20)19-14-27-24(29-23(19)33)28-21-6-7-22(31-30-21)32-12-10-25-11-13-32/h6-9,14-17,25H,2-5,10-13H2,1H3,(H,27,28,29,30) |
| InChIKey | SIEQAYSHYKILTK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |