C18H26N4O — CID 90654501
1-[3-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)phenoxy]propyl]piperidine (PubChem CID 90654501) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-[3-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)phenoxy]propyl]piperidine.
| Compound Name | 1-[3-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)phenoxy]propyl]piperidine |
|---|---|
| PubChem CID | 90654501 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-[3-[4-(3,5-dimethyl-1,2,4-triazol-4-yl)phenoxy]propyl]piperidine |
| SMILES | Cc1nnc(C)n1-c1ccc(OCCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C18H26N4O/c1-15-19-20-16(2)22(15)17-7-9-18(10-8-17)23-14-6-13-21-11-4-3-5-12-21/h7-10H,3-6,11-14H2,1-2H3 |
| InChIKey | BAAHTFHSCKWFDS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|