C26H31N3O6S — CID 90654504
(3S)-4-[4-[3-[(4-methoxy-2-pyridinyl)amino]propoxy]phenyl]-3-[(4-methylphenyl)sulfonylamino]butanoic acid (PubChem CID 90654504) has the molecular formula C26H31N3O6S and a molecular weight of 513.62 g/mol. Its IUPAC name is (3S)-4-[4-[3-[(4-methoxy-2-pyridinyl)amino]propoxy]phenyl]-3-[(4-methylphenyl)sulfonylamino]butanoic acid.
| Compound Name | (3S)-4-[4-[3-[(4-methoxy-2-pyridinyl)amino]propoxy]phenyl]-3-[(4-methylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 90654504 |
| Molecular Formula | C26H31N3O6S |
| Molecular Weight | 513.62 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | (3S)-4-[4-[3-[(4-methoxy-2-pyridinyl)amino]propoxy]phenyl]-3-[(4-methylphenyl)sulfonylamino]butanoic acid |
| SMILES | COc1ccnc(NCCCOc2ccc(C[C@@H](CC(=O)O)NS(=O)(=O)c3ccc(C)cc3)cc2)c1 |
| InChI | InChI=1S/C26H31N3O6S/c1-19-4-10-24(11-5-19)36(32,33)29-21(17-26(30)31)16-20-6-8-22(9-7-20)35-15-3-13-27-25-18-23(34-2)12-14-28-25/h4-12,14,18,21,29H,3,13,15-17H2,1-2H3,(H,27,28)(H,30,31)/t21-/m0/s1 |
| InChIKey | NEEFZJDFXACOOY-NRFANRHFSA-N |
| XLogP | 3.64 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.62 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|