C17H14N2O4S — CID 90654516
4-[4-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]benzenesulfonamide (PubChem CID 90654516) has the molecular formula C17H14N2O4S and a molecular weight of 342.38 g/mol. Its IUPAC name is 4-[4-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]benzenesulfonamide.
| Compound Name | 4-[4-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90654516 |
| Molecular Formula | C17H14N2O4S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.07 |
| IUPAC Name | 4-[4-(4-methylphenyl)-2,5-dioxopyrrol-3-yl]benzenesulfonamide |
| SMILES | Cc1ccc(C2=C(c3ccc(S(N)(=O)=O)cc3)C(=O)NC2=O)cc1 |
| InChI | InChI=1S/C17H14N2O4S/c1-10-2-4-11(5-3-10)14-15(17(21)19-16(14)20)12-6-8-13(9-7-12)24(18,22)23/h2-9H,1H3,(H2,18,22,23)(H,19,20,21) |
| InChIKey | DRONBOFUARZCGK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|