C21H33NO3 — CID 906546
[(3S,5R,8R,9R,10R,13S,14R,17R)-17-formamido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate (PubChem CID 906546) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is [(3S,5R,8R,9R,10R,13S,14R,17R)-17-formamido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate.
| Compound Name | [(3S,5R,8R,9R,10R,13S,14R,17R)-17-formamido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
|---|---|
| PubChem CID | 906546 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | [(3S,5R,8R,9R,10R,13S,14R,17R)-17-formamido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] formate |
| SMILES | C[C@]12CC[C@@H]3[C@@H](CC[C@@H]4C[C@@H](OC=O)CC[C@]43C)[C@H]1CC[C@H]2NC=O |
| InChI | InChI=1S/C21H33NO3/c1-20-9-7-15(25-13-24)11-14(20)3-4-16-17-5-6-19(22-12-23)21(17,2)10-8-18(16)20/h12-19H,3-11H2,1-2H3,(H,22,23)/t14-,15+,16+,17-,18-,19-,20-,21+/m1/s1 |
| InChIKey | FFINRYRFPXXAGN-OETUHIFDSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|