C27H35N3O2 — CID 90654657
2,7,7-trimethyl-9-[8-(2-methylpropyl)-1-oxo-3,4-dihydro-2H-isoquinolin-6-yl]-3,4,6,8-tetrahydro-1H-pyrido[3,4-b]indol-5-one (PubChem CID 90654657) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 2,7,7-trimethyl-9-[8-(2-methylpropyl)-1-oxo-3,4-dihydro-2H-isoquinolin-6-yl]-3,4,6,8-tetrahydro-1H-pyrido[3,4-b]indol-5-one.
| Compound Name | 2,7,7-trimethyl-9-[8-(2-methylpropyl)-1-oxo-3,4-dihydro-2H-isoquinolin-6-yl]-3,4,6,8-tetrahydro-1H-pyrido[3,4-b]indol-5-one |
|---|---|
| PubChem CID | 90654657 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | 2,7,7-trimethyl-9-[8-(2-methylpropyl)-1-oxo-3,4-dihydro-2H-isoquinolin-6-yl]-3,4,6,8-tetrahydro-1H-pyrido[3,4-b]indol-5-one |
| SMILES | CC(C)Cc1cc(-n2c3c(c4c2CC(C)(C)CC4=O)CCN(C)C3)cc2c1C(=O)NCC2 |
| InChI | InChI=1S/C27H35N3O2/c1-16(2)10-18-12-19(11-17-6-8-28-26(32)24(17)18)30-21-13-27(3,4)14-23(31)25(21)20-7-9-29(5)15-22(20)30/h11-12,16H,6-10,13-15H2,1-5H3,(H,28,32) |
| InChIKey | JEHITPSPEWPKHP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |