C26H32Cl2N4O2 — CID 90654684
(3S)-2-[6-[4-(2,3-dichlorophenyl)piperazin-1-yl]hexanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 90654684) has the molecular formula C26H32Cl2N4O2 and a molecular weight of 503.47 g/mol. Its IUPAC name is (3S)-2-[6-[4-(2,3-dichlorophenyl)piperazin-1-yl]hexanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | (3S)-2-[6-[4-(2,3-dichlorophenyl)piperazin-1-yl]hexanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 90654684 |
| Molecular Formula | C26H32Cl2N4O2 |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | (3S)-2-[6-[4-(2,3-dichlorophenyl)piperazin-1-yl]hexanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | NC(=O)[C@@H]1Cc2ccccc2CN1C(=O)CCCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
| InChI | InChI=1S/C26H32Cl2N4O2/c27-21-9-6-10-22(25(21)28)31-15-13-30(14-16-31)12-5-1-2-11-24(33)32-18-20-8-4-3-7-19(20)17-23(32)26(29)34/h3-4,6-10,23H,1-2,5,11-18H2,(H2,29,34)/t23-/m0/s1 |
| InChIKey | ZRCLMNFYEJGGIS-QHCPKHFHSA-N |
| XLogP | 4.11 |
| TPSA | 69.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|