C13H18F3NO2 — CID 906547
(1S,3S,6R,7S)-6,7-dimethyl-N-(2,2,2-trifluoroethyl)-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxamide (PubChem CID 906547) has the molecular formula C13H18F3NO2 and a molecular weight of 277.29 g/mol. Its IUPAC name is (1S,3S,6R,7S)-6,7-dimethyl-N-(2,2,2-trifluoroethyl)-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxamide.
| Compound Name | (1S,3S,6R,7S)-6,7-dimethyl-N-(2,2,2-trifluoroethyl)-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxamide |
|---|---|
| PubChem CID | 906547 |
| Molecular Formula | C13H18F3NO2 |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | (1S,3S,6R,7S)-6,7-dimethyl-N-(2,2,2-trifluoroethyl)-4-oxatricyclo[4.3.0.03,7]nonane-3-carboxamide |
| SMILES | C[C@@]12CC[C@H]3C[C@]1(C(=O)NCC(F)(F)F)OC[C@]32C |
| InChI | InChI=1S/C13H18F3NO2/c1-10-7-19-12(9(18)17-6-13(14,15)16)5-8(10)3-4-11(10,12)2/h8H,3-7H2,1-2H3,(H,17,18)/t8-,10+,11-,12+/m0/s1 |
| InChIKey | NOPWOZZLZKHIRI-ZDDJMSTPSA-N |
| XLogP | 2.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |