About 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile
4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile (PubChem CID 90654715) has the molecular formula C19H17F2N3O
and a molecular weight of 341.36 g/mol. Its IUPAC name is 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile |
| PubChem CID | 90654715 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile |
| SMILES | N#Cc1ccc(N2C[C@H](CN)[C@@H](c3cc(F)ccc3F)CC2=O)cc1 |
| InChI | InChI=1S/C19H17F2N3O/c20-14-3-6-18(21)17(7-14)16-8-19(25)24(11-13(16)10-23)15-4-1-12(9-22)2-5-15/h1-7,13,16H,8,10-11,23H2/t13-,16-/m0/s1 |
| InChIKey | QIPHKAKIYMTZAD-BBRMVZONSA-N |
| XLogP | 2.93 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile?
The IUPAC name of 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile (CID 90654715) is 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile.
What is the SMILES notation for 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile?
The canonical SMILES for 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile is N#Cc1ccc(N2C[C@H](CN)[C@@H](c3cc(F)ccc3F)CC2=O)cc1.
What is the InChIKey of 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile?
The InChIKey is QIPHKAKIYMTZAD-BBRMVZONSA-N. The full InChI is InChI=1S/C19H17F2N3O/c20-14-3-6-18(21)17(7-14)16-8-19(25)24(11-13(16)10-23)15-4-1-12(9-22)2-5-15/h1-7,13,16H,8,10-11,23H2/t13-,16-/m0/s1.
What are the key properties of 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile?
4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile has a molecular weight of 341.36 g/mol, XLogP of 2.93, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-2-oxopiperidin-1-yl]benzonitrile is sourced from PubChem (CID 90654715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).