About (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one
(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one (PubChem CID 90654718) has the molecular formula C19H20F2N2O2
and a molecular weight of 346.38 g/mol. Its IUPAC name is (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one.
Molecular Properties
| Compound Name | (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one |
| PubChem CID | 90654718 |
| Molecular Formula | C19H20F2N2O2 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one |
| SMILES | COc1ccc(N2C[C@H](CN)[C@@H](c3cc(F)ccc3F)CC2=O)cc1 |
| InChI | InChI=1S/C19H20F2N2O2/c1-25-15-5-3-14(4-6-15)23-11-12(10-22)16(9-19(23)24)17-8-13(20)2-7-18(17)21/h2-8,12,16H,9-11,22H2,1H3/t12-,16-/m0/s1 |
| InChIKey | AKRQFSGTFVOMDX-LRDDRELGSA-N |
| XLogP | 3.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one?
The IUPAC name of (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one (CID 90654718) is (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one.
What is the SMILES notation for (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one?
The canonical SMILES for (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one is COc1ccc(N2C[C@H](CN)[C@@H](c3cc(F)ccc3F)CC2=O)cc1.
What is the InChIKey of (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one?
The InChIKey is AKRQFSGTFVOMDX-LRDDRELGSA-N. The full InChI is InChI=1S/C19H20F2N2O2/c1-25-15-5-3-14(4-6-15)23-11-12(10-22)16(9-19(23)24)17-8-13(20)2-7-18(17)21/h2-8,12,16H,9-11,22H2,1H3/t12-,16-/m0/s1.
What are the key properties of (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one?
(4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one has a molecular weight of 346.38 g/mol, XLogP of 3.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-5-(aminomethyl)-4-(2,5-difluorophenyl)-1-(4-methoxyphenyl)piperidin-2-one is sourced from PubChem (CID 90654718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).